C14H19N3O3 — CID 169114502
2-[(2R,5S)-2-(5-methoxy-3-pyridinyl)-5-methylpiperidin-1-yl]-2-oxoacetamide (PubChem CID 169114502) has the molecular formula C14H19N3O3 and a molecular weight of 277.32 g/mol. Its IUPAC name is 2-[(2R,5S)-2-(5-methoxy-3-pyridinyl)-5-methylpiperidin-1-yl]-2-oxoacetamide.
| Compound Name | 2-[(2R,5S)-2-(5-methoxy-3-pyridinyl)-5-methylpiperidin-1-yl]-2-oxoacetamide |
|---|---|
| PubChem CID | 169114502 |
| Molecular Formula | C14H19N3O3 |
| Molecular Weight | 277.32 g/mol |
| Exact Mass | 277.14 |
| IUPAC Name | 2-[(2R,5S)-2-(5-methoxy-3-pyridinyl)-5-methylpiperidin-1-yl]-2-oxoacetamide |
| SMILES | COc1cncc([C@H]2CC[C@H](C)CN2C(=O)C(N)=O)c1 |
| InChI | InChI=1S/C14H19N3O3/c1-9-3-4-12(17(8-9)14(19)13(15)18)10-5-11(20-2)7-16-6-10/h5-7,9,12H,3-4,8H2,1-2H3,(H2,15,18)/t9-,12+/m0/s1 |
| InChIKey | COBJOKKWFDVNFH-JOYOIKCWSA-N |
| XLogP | 0.88 |
| TPSA | 85.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.32 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|