C24H31NO — CID 158438247
4-ethyl-N-[(1S,2R)-2-(4-phenylmethoxyphenyl)cyclopropyl]cyclohexan-1-amine (PubChem CID 158438247) has the molecular formula C24H31NO and a molecular weight of 349.52 g/mol. Its IUPAC name is 4-ethyl-N-[(1S,2R)-2-(4-phenylmethoxyphenyl)cyclopropyl]cyclohexan-1-amine.
| Compound Name | 4-ethyl-N-[(1S,2R)-2-(4-phenylmethoxyphenyl)cyclopropyl]cyclohexan-1-amine |
|---|---|
| PubChem CID | 158438247 |
| Molecular Formula | C24H31NO |
| Molecular Weight | 349.52 g/mol |
| Exact Mass | 349.24 |
| IUPAC Name | 4-ethyl-N-[(1S,2R)-2-(4-phenylmethoxyphenyl)cyclopropyl]cyclohexan-1-amine |
| SMILES | CCC1CCC(N[C@H]2C[C@@H]2c2ccc(OCc3ccccc3)cc2)CC1 |
| InChI | InChI=1S/C24H31NO/c1-2-18-8-12-21(13-9-18)25-24-16-23(24)20-10-14-22(15-11-20)26-17-19-6-4-3-5-7-19/h3-7,10-11,14-15,18,21,23-25H,2,8-9,12-13,16-17H2,1H3/t18?,21?,23-,24+/m1/s1 |
| InChIKey | HCMMYWYGSGEMQU-VJZJYSEDSA-N |
| XLogP | 5.68 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.52 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |