C27H22N4O2 — CID 158439238
4-[8-hydroxy-7-(4-isocyanophenyl)-8-(3-methylphenyl)-6-oxo-5,7-diazaspiro[3.4]octan-5-yl]benzonitrile (PubChem CID 158439238) has the molecular formula C27H22N4O2 and a molecular weight of 434.50 g/mol. Its IUPAC name is 4-[8-hydroxy-7-(4-isocyanophenyl)-8-(3-methylphenyl)-6-oxo-5,7-diazaspiro[3.4]octan-5-yl]benzonitrile.
| Compound Name | 4-[8-hydroxy-7-(4-isocyanophenyl)-8-(3-methylphenyl)-6-oxo-5,7-diazaspiro[3.4]octan-5-yl]benzonitrile |
|---|---|
| PubChem CID | 158439238 |
| Molecular Formula | C27H22N4O2 |
| Molecular Weight | 434.50 g/mol |
| Exact Mass | 434.17 |
| IUPAC Name | 4-[8-hydroxy-7-(4-isocyanophenyl)-8-(3-methylphenyl)-6-oxo-5,7-diazaspiro[3.4]octan-5-yl]benzonitrile |
| SMILES | [C-]#[N+]c1ccc(N2C(=O)N(c3ccc(C#N)cc3)C3(CCC3)C2(O)c2cccc(C)c2)cc1 |
| InChI | InChI=1S/C27H22N4O2/c1-19-5-3-6-21(17-19)27(33)26(15-4-16-26)30(23-11-7-20(18-28)8-12-23)25(32)31(27)24-13-9-22(29-2)10-14-24/h3,5-14,17,33H,4,15-16H2,1H3 |
| InChIKey | TYOJVXHKIKOLGR-UHFFFAOYSA-N |
| XLogP | 5.63 |
| TPSA | 71.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.50 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|