C27H14F9N3O3 — CID 158440664
5,6-difluoro-1H-indole;5,6-difluoro-1H-indole-3-carboxylic acid;1-(5,6-difluoro-1H-indol-3-yl)-2,2,2-trifluoroethanone (PubChem CID 158440664) has the molecular formula C27H14F9N3O3 and a molecular weight of 599.41 g/mol. Its IUPAC name is 5,6-difluoro-1H-indole;5,6-difluoro-1H-indole-3-carboxylic acid;1-(5,6-difluoro-1H-indol-3-yl)-2,2,2-trifluoroethanone.
| Compound Name | 5,6-difluoro-1H-indole;5,6-difluoro-1H-indole-3-carboxylic acid;1-(5,6-difluoro-1H-indol-3-yl)-2,2,2-trifluoroethanone |
|---|---|
| PubChem CID | 158440664 |
| Molecular Formula | C27H14F9N3O3 |
| Molecular Weight | 599.41 g/mol |
| Exact Mass | 599.09 |
| IUPAC Name | 5,6-difluoro-1H-indole;5,6-difluoro-1H-indole-3-carboxylic acid;1-(5,6-difluoro-1H-indol-3-yl)-2,2,2-trifluoroethanone |
| SMILES | Fc1cc2cc[nH]c2cc1F.O=C(O)c1c[nH]c2cc(F)c(F)cc12.O=C(c1c[nH]c2cc(F)c(F)cc12)C(F)(F)F |
| InChI | InChI=1S/C10H4F5NO.C9H5F2NO2.C8H5F2N/c11-6-1-4-5(9(17)10(13,14)15)3-16-8(4)2-7(6)12;10-6-1-4-5(9(13)14)3-12-8(4)2-7(6)11;9-6-3-5-1-2-11-8(5)4-7(6)10/h1-3,16H;1-3,12H,(H,13,14);1-4,11H |
| InChIKey | HCTUFPWHKHWQNQ-UHFFFAOYSA-N |
| XLogP | 7.78 |
| TPSA | 101.74 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 599.41 |
| LogP ≤ 5 | 7.78 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 2 |