C28H22BBrF6N2O4 — CID 158441090
1-(6-bromo-2-pyridinyl)ethanone;[3-(trifluoromethyl)phenyl]boronic acid;1-[6-[3-(trifluoromethyl)phenyl]-2-pyridinyl]ethanone (PubChem CID 158441090) has the molecular formula C28H22BBrF6N2O4 and a molecular weight of 655.20 g/mol. Its IUPAC name is 1-(6-bromo-2-pyridinyl)ethanone;[3-(trifluoromethyl)phenyl]boronic acid;1-[6-[3-(trifluoromethyl)phenyl]-2-pyridinyl]ethanone.
| Compound Name | 1-(6-bromo-2-pyridinyl)ethanone;[3-(trifluoromethyl)phenyl]boronic acid;1-[6-[3-(trifluoromethyl)phenyl]-2-pyridinyl]ethanone |
|---|---|
| PubChem CID | 158441090 |
| Molecular Formula | C28H22BBrF6N2O4 |
| Molecular Weight | 655.20 g/mol |
| Exact Mass | 654.08 |
| IUPAC Name | 1-(6-bromo-2-pyridinyl)ethanone;[3-(trifluoromethyl)phenyl]boronic acid;1-[6-[3-(trifluoromethyl)phenyl]-2-pyridinyl]ethanone |
| SMILES | CC(=O)c1cccc(-c2cccc(C(F)(F)F)c2)n1.CC(=O)c1cccc(Br)n1.OB(O)c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C14H10F3NO.C7H6BF3O2.C7H6BrNO/c1-9(19)12-6-3-7-13(18-12)10-4-2-5-11(8-10)14(15,16)17;9-7(10,11)5-2-1-3-6(4-5)8(12)13;1-5(10)6-3-2-4-7(8)9-6/h2-8H,1H3;1-4,12-13H;2-4H,1H3 |
| InChIKey | HCUYBKDVJCKNMF-UHFFFAOYSA-N |
| XLogP | 6.40 |
| TPSA | 100.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 655.20 |
| LogP ≤ 5 | 6.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|