C20H36N2O6 — CID 158443232
tert-butyl 2,2,6,6-tetradeuterio-4-hydroxypiperidine-1-carboxylate;tert-butyl 2,2,6,6-tetradeuterio-4-oxopiperidine-1-carboxylate (PubChem CID 158443232) has the molecular formula C20H36N2O6 and a molecular weight of 408.56 g/mol. Its IUPAC name is tert-butyl 2,2,6,6-tetradeuterio-4-hydroxypiperidine-1-carboxylate;tert-butyl 2,2,6,6-tetradeuterio-4-oxopiperidine-1-carboxylate.
| Compound Name | tert-butyl 2,2,6,6-tetradeuterio-4-hydroxypiperidine-1-carboxylate;tert-butyl 2,2,6,6-tetradeuterio-4-oxopiperidine-1-carboxylate |
|---|---|
| PubChem CID | 158443232 |
| Molecular Formula | C20H36N2O6 |
| Molecular Weight | 408.56 g/mol |
| Exact Mass | 408.31 |
| IUPAC Name | tert-butyl 2,2,6,6-tetradeuterio-4-hydroxypiperidine-1-carboxylate;tert-butyl 2,2,6,6-tetradeuterio-4-oxopiperidine-1-carboxylate |
| SMILES | [2H]C1([2H])CC(=O)CC([2H])([2H])N1C(=O)OC(C)(C)C.[2H]C1([2H])CC(O)CC([2H])([2H])N1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C10H19NO3.C10H17NO3/c2*1-10(2,3)14-9(13)11-6-4-8(12)5-7-11/h8,12H,4-7H2,1-3H3;4-7H2,1-3H3/i2*6D2,7D2 |
| InChIKey | HDBNNVKFPAJOOH-SRNIYDQQSA-N |
| XLogP | 2.96 |
| TPSA | 96.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.56 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |