C19H25NO3 — CID 158443527
benzyl 2-[(1S,3R)-3-(2-oxopyrrolidin-1-yl)cyclohexyl]acetate (PubChem CID 158443527) has the molecular formula C19H25NO3 and a molecular weight of 315.41 g/mol. Its IUPAC name is benzyl 2-[(1S,3R)-3-(2-oxopyrrolidin-1-yl)cyclohexyl]acetate.
| Compound Name | benzyl 2-[(1S,3R)-3-(2-oxopyrrolidin-1-yl)cyclohexyl]acetate |
|---|---|
| PubChem CID | 158443527 |
| Molecular Formula | C19H25NO3 |
| Molecular Weight | 315.41 g/mol |
| Exact Mass | 315.18 |
| IUPAC Name | benzyl 2-[(1S,3R)-3-(2-oxopyrrolidin-1-yl)cyclohexyl]acetate |
| SMILES | O=C(C[C@H]1CCC[C@@H](N2CCCC2=O)C1)OCc1ccccc1 |
| InChI | InChI=1S/C19H25NO3/c21-18-10-5-11-20(18)17-9-4-8-16(12-17)13-19(22)23-14-15-6-2-1-3-7-15/h1-3,6-7,16-17H,4-5,8-14H2/t16-,17+/m0/s1 |
| InChIKey | QIBZSZPPPNBKQW-DLBZAZTESA-N |
| XLogP | 3.30 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.41 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |