C9H17NO2 — CID 158444021
tert-butyl 2-(1,1,1,3,3,3-hexadeuteriopropan-2-ylideneamino)acetate (PubChem CID 158444021) has the molecular formula C9H17NO2 and a molecular weight of 177.28 g/mol. Its IUPAC name is tert-butyl 2-(1,1,1,3,3,3-hexadeuteriopropan-2-ylideneamino)acetate.
| Compound Name | tert-butyl 2-(1,1,1,3,3,3-hexadeuteriopropan-2-ylideneamino)acetate |
|---|---|
| PubChem CID | 158444021 |
| Molecular Formula | C9H17NO2 |
| Molecular Weight | 177.28 g/mol |
| Exact Mass | 177.16 |
| IUPAC Name | tert-butyl 2-(1,1,1,3,3,3-hexadeuteriopropan-2-ylideneamino)acetate |
| SMILES | [2H]C([2H])([2H])C(=NCC(=O)OC(C)(C)C)C([2H])([2H])[2H] |
| InChI | InChI=1S/C9H17NO2/c1-7(2)10-6-8(11)12-9(3,4)5/h6H2,1-5H3/i1D3,2D3 |
| InChIKey | LNFFTVLYIHMFRN-WFGJKAKNSA-N |
| XLogP | 1.81 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 177.28 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|