About (3-methoxy-2,3-dimethylbutan-2-yl) 2-(propan-2-ylideneamino)acetate
(3-methoxy-2,3-dimethylbutan-2-yl) 2-(propan-2-ylideneamino)acetate (PubChem CID 59969206) has the molecular formula C12H23NO3
and a molecular weight of 229.32 g/mol. Its IUPAC name is (3-methoxy-2,3-dimethylbutan-2-yl) 2-(propan-2-ylideneamino)acetate.
Molecular Properties
| Compound Name | (3-methoxy-2,3-dimethylbutan-2-yl) 2-(propan-2-ylideneamino)acetate |
| PubChem CID | 59969206 |
| Molecular Formula | C12H23NO3 |
| Molecular Weight | 229.32 g/mol |
| Exact Mass | 229.17 |
| IUPAC Name | (3-methoxy-2,3-dimethylbutan-2-yl) 2-(propan-2-ylideneamino)acetate |
| SMILES | COC(C)(C)C(C)(C)OC(=O)CN=C(C)C |
| InChI | InChI=1S/C12H23NO3/c1-9(2)13-8-10(14)16-12(5,6)11(3,4)15-7/h8H2,1-7H3 |
| InChIKey | SSQWZJBYYIGGNP-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 47.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 229.32 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze (3-methoxy-2,3-dimethylbutan-2-yl) 2-(propan-2-ylideneamino)acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3-methoxy-2,3-dimethylbutan-2-yl) 2-(propan-2-ylideneamino)acetate?
The IUPAC name of (3-methoxy-2,3-dimethylbutan-2-yl) 2-(propan-2-ylideneamino)acetate (CID 59969206) is (3-methoxy-2,3-dimethylbutan-2-yl) 2-(propan-2-ylideneamino)acetate.
What is the SMILES notation for (3-methoxy-2,3-dimethylbutan-2-yl) 2-(propan-2-ylideneamino)acetate?
The canonical SMILES for (3-methoxy-2,3-dimethylbutan-2-yl) 2-(propan-2-ylideneamino)acetate is COC(C)(C)C(C)(C)OC(=O)CN=C(C)C.
What is the InChIKey of (3-methoxy-2,3-dimethylbutan-2-yl) 2-(propan-2-ylideneamino)acetate?
The InChIKey is SSQWZJBYYIGGNP-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H23NO3/c1-9(2)13-8-10(14)16-12(5,6)11(3,4)15-7/h8H2,1-7H3.
What are the key properties of (3-methoxy-2,3-dimethylbutan-2-yl) 2-(propan-2-ylideneamino)acetate?
(3-methoxy-2,3-dimethylbutan-2-yl) 2-(propan-2-ylideneamino)acetate has a molecular weight of 229.32 g/mol, XLogP of 2.21, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (3-methoxy-2,3-dimethylbutan-2-yl) 2-(propan-2-ylideneamino)acetate is sourced from PubChem (CID 59969206), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).