C19H30OW — CID 158446686
1-[4-(2,2-dimethylpropyl)phenyl]pentan-1-one;propane;tungsten(2+) (PubChem CID 158446686) has the molecular formula C19H30OW and a molecular weight of 458.29 g/mol. Its IUPAC name is 1-[4-(2,2-dimethylpropyl)phenyl]pentan-1-one;propane;tungsten(2+).
| Compound Name | 1-[4-(2,2-dimethylpropyl)phenyl]pentan-1-one;propane;tungsten(2+) |
|---|---|
| PubChem CID | 158446686 |
| Molecular Formula | C19H30OW |
| Molecular Weight | 458.29 g/mol |
| Exact Mass | 458.18 |
| IUPAC Name | 1-[4-(2,2-dimethylpropyl)phenyl]pentan-1-one;propane;tungsten(2+) |
| SMILES | [CH2-]CC.[CH2-]CCCC(=O)c1ccc(CC(C)(C)C)cc1.[W+2] |
| InChI | InChI=1S/C16H23O.C3H7.W/c1-5-6-7-15(17)14-10-8-13(9-11-14)12-16(2,3)4;1-3-2;/h8-11H,1,5-7,12H2,2-4H3;1,3H2,2H3;/q2*-1;+2 |
| InChIKey | HDMADBANTBRTPD-UHFFFAOYSA-N |
| XLogP | 5.69 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.29 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|