C26H36O3 — CID 158795008
1-[4-(2,2-dimethylpropyl)phenyl]ethenol;methyl 4-(2,2-dimethylpropyl)benzoate (PubChem CID 158795008) has the molecular formula C26H36O3 and a molecular weight of 396.57 g/mol. Its IUPAC name is 1-[4-(2,2-dimethylpropyl)phenyl]ethenol;methyl 4-(2,2-dimethylpropyl)benzoate.
| Compound Name | 1-[4-(2,2-dimethylpropyl)phenyl]ethenol;methyl 4-(2,2-dimethylpropyl)benzoate |
|---|---|
| PubChem CID | 158795008 |
| Molecular Formula | C26H36O3 |
| Molecular Weight | 396.57 g/mol |
| Exact Mass | 396.27 |
| IUPAC Name | 1-[4-(2,2-dimethylpropyl)phenyl]ethenol;methyl 4-(2,2-dimethylpropyl)benzoate |
| SMILES | C=C(O)c1ccc(CC(C)(C)C)cc1.COC(=O)c1ccc(CC(C)(C)C)cc1 |
| InChI | InChI=1S/C13H18O2.C13H18O/c1-13(2,3)9-10-5-7-11(8-6-10)12(14)15-4;1-10(14)12-7-5-11(6-8-12)9-13(2,3)4/h5-8H,9H2,1-4H3;5-8,14H,1,9H2,2-4H3 |
| InChIKey | ISTIJYSJAQFFBI-UHFFFAOYSA-N |
| XLogP | 6.87 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.57 |
| LogP ≤ 5 | 6.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|