C28H23Br2ClN2O5 — CID 158448755
methyl 2-[2-(4-bromophenyl)ethyl]-6-chloropyridine-3-carboxylate;methyl 2-(4-bromophenyl)-1-oxidopyridin-1-ium-3-carboxylate (PubChem CID 158448755) has the molecular formula C28H23Br2ClN2O5 and a molecular weight of 662.76 g/mol. Its IUPAC name is methyl 2-[2-(4-bromophenyl)ethyl]-6-chloropyridine-3-carboxylate;methyl 2-(4-bromophenyl)-1-oxidopyridin-1-ium-3-carboxylate.
| Compound Name | methyl 2-[2-(4-bromophenyl)ethyl]-6-chloropyridine-3-carboxylate;methyl 2-(4-bromophenyl)-1-oxidopyridin-1-ium-3-carboxylate |
|---|---|
| PubChem CID | 158448755 |
| Molecular Formula | C28H23Br2ClN2O5 |
| Molecular Weight | 662.76 g/mol |
| Exact Mass | 659.97 |
| IUPAC Name | methyl 2-[2-(4-bromophenyl)ethyl]-6-chloropyridine-3-carboxylate;methyl 2-(4-bromophenyl)-1-oxidopyridin-1-ium-3-carboxylate |
| SMILES | COC(=O)c1ccc(Cl)nc1CCc1ccc(Br)cc1.COC(=O)c1ccc[n+]([O-])c1-c1ccc(Br)cc1 |
| InChI | InChI=1S/C15H13BrClNO2.C13H10BrNO3/c1-20-15(19)12-7-9-14(17)18-13(12)8-4-10-2-5-11(16)6-3-10;1-18-13(16)11-3-2-8-15(17)12(11)9-4-6-10(14)7-5-9/h2-3,5-7,9H,4,8H2,1H3;2-8H,1H3 |
| InChIKey | HDSFUIKRAKUUDM-UHFFFAOYSA-N |
| XLogP | 6.61 |
| TPSA | 92.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 662.76 |
| LogP ≤ 5 | 6.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|