C26H32ClN5O4 — CID 158450776
3-[7-[4-[(7-chloro-4-oxoquinazolin-3-yl)methyl]-4-hydroxypiperidin-1-yl]-7-oxoheptanoyl]pyrrolidine-1-carbonitrile (PubChem CID 158450776) has the molecular formula C26H32ClN5O4 and a molecular weight of 514.03 g/mol. Its IUPAC name is 3-[7-[4-[(7-chloro-4-oxoquinazolin-3-yl)methyl]-4-hydroxypiperidin-1-yl]-7-oxoheptanoyl]pyrrolidine-1-carbonitrile.
| Compound Name | 3-[7-[4-[(7-chloro-4-oxoquinazolin-3-yl)methyl]-4-hydroxypiperidin-1-yl]-7-oxoheptanoyl]pyrrolidine-1-carbonitrile |
|---|---|
| PubChem CID | 158450776 |
| Molecular Formula | C26H32ClN5O4 |
| Molecular Weight | 514.03 g/mol |
| Exact Mass | 513.21 |
| IUPAC Name | 3-[7-[4-[(7-chloro-4-oxoquinazolin-3-yl)methyl]-4-hydroxypiperidin-1-yl]-7-oxoheptanoyl]pyrrolidine-1-carbonitrile |
| SMILES | N#CN1CCC(C(=O)CCCCCC(=O)N2CCC(O)(Cn3cnc4cc(Cl)ccc4c3=O)CC2)C1 |
| InChI | InChI=1S/C26H32ClN5O4/c27-20-6-7-21-22(14-20)29-18-32(25(21)35)16-26(36)9-12-31(13-10-26)24(34)5-3-1-2-4-23(33)19-8-11-30(15-19)17-28/h6-7,14,18-19,36H,1-5,8-13,15-16H2 |
| InChIKey | HDYKNYGNRJTGQE-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 119.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.03 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'} |
|---|