C16H17ClN4O3 — CID 39011474
(3R)-1-[2-(7-chloro-4-oxoquinazolin-3-yl)acetyl]piperidine-3-carboxamide (PubChem CID 39011474) has the molecular formula C16H17ClN4O3 and a molecular weight of 348.79 g/mol. Its IUPAC name is (3R)-1-[2-(7-chloro-4-oxoquinazolin-3-yl)acetyl]piperidine-3-carboxamide.
| Compound Name | (3R)-1-[2-(7-chloro-4-oxoquinazolin-3-yl)acetyl]piperidine-3-carboxamide |
|---|---|
| PubChem CID | 39011474 |
| Molecular Formula | C16H17ClN4O3 |
| Molecular Weight | 348.79 g/mol |
| Exact Mass | 348.10 |
| IUPAC Name | (3R)-1-[2-(7-chloro-4-oxoquinazolin-3-yl)acetyl]piperidine-3-carboxamide |
| SMILES | NC(=O)[C@@H]1CCCN(C(=O)Cn2cnc3cc(Cl)ccc3c2=O)C1 |
| InChI | InChI=1S/C16H17ClN4O3/c17-11-3-4-12-13(6-11)19-9-21(16(12)24)8-14(22)20-5-1-2-10(7-20)15(18)23/h3-4,6,9-10H,1-2,5,7-8H2,(H2,18,23)/t10-/m1/s1 |
| InChIKey | PYCQKNXLOJPAJJ-SNVBAGLBSA-N |
| XLogP | 0.77 |
| TPSA | 98.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.79 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |