C45H32N10O2 — CID 158451098
3-(1H-imidazo[4,5-f][1,10]phenanthrolin-2-yl)-2-methyl-1H-indol-5-ol;2-(5-methoxy-2-methyl-1H-indol-3-yl)-1H-imidazo[4,5-f][1,10]phenanthroline (PubChem CID 158451098) has the molecular formula C45H32N10O2 and a molecular weight of 744.82 g/mol. Its IUPAC name is 3-(1H-imidazo[4,5-f][1,10]phenanthrolin-2-yl)-2-methyl-1H-indol-5-ol;2-(5-methoxy-2-methyl-1H-indol-3-yl)-1H-imidazo[4,5-f][1,10]phenanthroline.
| Compound Name | 3-(1H-imidazo[4,5-f][1,10]phenanthrolin-2-yl)-2-methyl-1H-indol-5-ol;2-(5-methoxy-2-methyl-1H-indol-3-yl)-1H-imidazo[4,5-f][1,10]phenanthroline |
|---|---|
| PubChem CID | 158451098 |
| Molecular Formula | C45H32N10O2 |
| Molecular Weight | 744.82 g/mol |
| Exact Mass | 744.27 |
| IUPAC Name | 3-(1H-imidazo[4,5-f][1,10]phenanthrolin-2-yl)-2-methyl-1H-indol-5-ol;2-(5-methoxy-2-methyl-1H-indol-3-yl)-1H-imidazo[4,5-f][1,10]phenanthroline |
| SMILES | COc1ccc2[nH]c(C)c(-c3nc4c5cccnc5c5ncccc5c4[nH]3)c2c1.Cc1[nH]c2ccc(O)cc2c1-c1nc2c3cccnc3c3ncccc3c2[nH]1 |
| InChI | InChI=1S/C23H17N5O.C22H15N5O/c1-12-18(16-11-13(29-2)7-8-17(16)26-12)23-27-21-14-5-3-9-24-19(14)20-15(22(21)28-23)6-4-10-25-20;1-11-17(15-10-12(28)6-7-16(15)25-11)22-26-20-13-4-2-8-23-18(13)19-14(21(20)27-22)5-3-9-24-19/h3-11,26H,1-2H3,(H,27,28);2-10,25,28H,1H3,(H,26,27) |
| InChIKey | HDZLQAMZRCSVDP-UHFFFAOYSA-N |
| XLogP | 9.95 |
| TPSA | 169.96 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 744.82 |
| LogP ≤ 5 | 9.95 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|