C55H59NO2 — CID 158452101
1-[2-(4-methylphenyl)-7-[4-(N-(4-methylphenyl)anilino)phenyl]-9-octanoylfluoren-9-yl]octan-1-one (PubChem CID 158452101) has the molecular formula C55H59NO2 and a molecular weight of 766.08 g/mol. Its IUPAC name is 1-[2-(4-methylphenyl)-7-[4-(N-(4-methylphenyl)anilino)phenyl]-9-octanoylfluoren-9-yl]octan-1-one.
| Compound Name | 1-[2-(4-methylphenyl)-7-[4-(N-(4-methylphenyl)anilino)phenyl]-9-octanoylfluoren-9-yl]octan-1-one |
|---|---|
| PubChem CID | 158452101 |
| Molecular Formula | C55H59NO2 |
| Molecular Weight | 766.08 g/mol |
| Exact Mass | 765.45 |
| IUPAC Name | 1-[2-(4-methylphenyl)-7-[4-(N-(4-methylphenyl)anilino)phenyl]-9-octanoylfluoren-9-yl]octan-1-one |
| SMILES | CCCCCCCC(=O)C1(C(=O)CCCCCCC)c2cc(-c3ccc(C)cc3)ccc2-c2ccc(-c3ccc(N(c4ccccc4)c4ccc(C)cc4)cc3)cc21 |
| InChI | InChI=1S/C55H59NO2/c1-5-7-9-11-16-20-53(57)55(54(58)21-17-12-10-8-6-2)51-38-44(42-26-22-40(3)23-27-42)30-36-49(51)50-37-31-45(39-52(50)55)43-28-34-48(35-29-43)56(46-18-14-13-15-19-46)47-32-24-41(4)25-33-47/h13-15,18-19,22-39H,5-12,16-17,20-21H2,1-4H3 |
| InChIKey | PITUVXFYIHKNQK-UHFFFAOYSA-N |
| XLogP | 15.23 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 766.08 |
| LogP ≤ 5 | 15.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|