C10H14O10 — CID 158453165
acetic acid;butanedioic acid;(E)-but-2-enedioic acid (PubChem CID 158453165) has the molecular formula C10H14O10 and a molecular weight of 294.21 g/mol. Its IUPAC name is acetic acid;butanedioic acid;(E)-but-2-enedioic acid.
| Compound Name | acetic acid;butanedioic acid;(E)-but-2-enedioic acid |
|---|---|
| PubChem CID | 158453165 |
| Molecular Formula | C10H14O10 |
| Molecular Weight | 294.21 g/mol |
| Exact Mass | 294.06 |
| IUPAC Name | acetic acid;butanedioic acid;(E)-but-2-enedioic acid |
| SMILES | CC(=O)O.O=C(O)/C=C/C(=O)O.O=C(O)CCC(=O)O |
| InChI | InChI=1S/C4H6O4.C4H4O4.C2H4O2/c2*5-3(6)1-2-4(7)8;1-2(3)4/h1-2H2,(H,5,6)(H,7,8);1-2H,(H,5,6)(H,7,8);1H3,(H,3,4)/b;2-1+; |
| InChIKey | HEGARRLLYHXVTI-JITBQSAISA-N |
| XLogP | -0.26 |
| TPSA | 186.50 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.21 |
| LogP ≤ 5 | -0.26 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|