C18H24O16 — CID 172744714
butanedioic acid;bis(but-2-enedioic acid);hexanedioic acid (PubChem CID 172744714) has the molecular formula C18H24O16 and a molecular weight of 496.37 g/mol. Its IUPAC name is butanedioic acid;bis(but-2-enedioic acid);hexanedioic acid.
| Compound Name | butanedioic acid;bis(but-2-enedioic acid);hexanedioic acid |
|---|---|
| PubChem CID | 172744714 |
| Molecular Formula | C18H24O16 |
| Molecular Weight | 496.37 g/mol |
| Exact Mass | 496.11 |
| IUPAC Name | butanedioic acid;bis(but-2-enedioic acid);hexanedioic acid |
| SMILES | O=C(O)C=CC(=O)O.O=C(O)C=CC(=O)O.O=C(O)CCC(=O)O.O=C(O)CCCCC(=O)O |
| InChI | InChI=1S/C6H10O4.C4H6O4.2C4H4O4/c7-5(8)3-1-2-4-6(9)10;3*5-3(6)1-2-4(7)8/h1-4H2,(H,7,8)(H,9,10);1-2H2,(H,5,6)(H,7,8);2*1-2H,(H,5,6)(H,7,8) |
| InChIKey | JOKIYXCZIBGDJH-UHFFFAOYSA-N |
| XLogP | 0.08 |
| TPSA | 298.40 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.37 |
| LogP ≤ 5 | 0.08 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|