C20H34O12 — CID 137367158
butanedioic acid;decanedioic acid;hexanedioic acid (PubChem CID 137367158) has the molecular formula C20H34O12 and a molecular weight of 466.48 g/mol. Its IUPAC name is butanedioic acid;decanedioic acid;hexanedioic acid.
| Compound Name | butanedioic acid;decanedioic acid;hexanedioic acid |
|---|---|
| PubChem CID | 137367158 |
| Molecular Formula | C20H34O12 |
| Molecular Weight | 466.48 g/mol |
| Exact Mass | 466.21 |
| IUPAC Name | butanedioic acid;decanedioic acid;hexanedioic acid |
| SMILES | O=C(O)CCC(=O)O.O=C(O)CCCCC(=O)O.O=C(O)CCCCCCCCC(=O)O |
| InChI | InChI=1S/C10H18O4.C6H10O4.C4H6O4/c11-9(12)7-5-3-1-2-4-6-8-10(13)14;7-5(8)3-1-2-4-6(9)10;5-3(6)1-2-4(7)8/h1-8H2,(H,11,12)(H,13,14);1-4H2,(H,7,8)(H,9,10);1-2H2,(H,5,6)(H,7,8) |
| InChIKey | ZOMAJHVXXGRIQM-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 223.80 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.48 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|