About methyl 3H-benzimidazole-5-carboxylate;bis(methyl 3-methylbenzimidazole-5-carboxylate)
methyl 3H-benzimidazole-5-carboxylate;bis(methyl 3-methylbenzimidazole-5-carboxylate) (PubChem CID 158454175) has the molecular formula C29H28N6O6
and a molecular weight of 556.58 g/mol. Its IUPAC name is methyl 3H-benzimidazole-5-carboxylate;bis(methyl 3-methylbenzimidazole-5-carboxylate).
Molecular Properties
| Compound Name | methyl 3H-benzimidazole-5-carboxylate;bis(methyl 3-methylbenzimidazole-5-carboxylate) |
| PubChem CID | 158454175 |
| Molecular Formula | C29H28N6O6 |
| Molecular Weight | 556.58 g/mol |
| Exact Mass | 556.21 |
| IUPAC Name | methyl 3H-benzimidazole-5-carboxylate;bis(methyl 3-methylbenzimidazole-5-carboxylate) |
| SMILES | COC(=O)c1ccc2nc[nH]c2c1.COC(=O)c1ccc2ncn(C)c2c1.COC(=O)c1ccc2ncn(C)c2c1 |
| InChI | InChI=1S/2C10H10N2O2.C9H8N2O2/c2*1-12-6-11-8-4-3-7(5-9(8)12)10(13)14-2;1-13-9(12)6-2-3-7-8(4-6)11-5-10-7/h2*3-6H,1-2H3;2-5H,1H3,(H,10,11) |
| InChIKey | HEJDMQKDFTZHHR-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 143.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 41 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 556.58 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|
Analyze methyl 3H-benzimidazole-5-carboxylate;bis(methyl 3-methylbenzimidazole-5-carboxylate) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 3H-benzimidazole-5-carboxylate;bis(methyl 3-methylbenzimidazole-5-carboxylate)?
The IUPAC name of methyl 3H-benzimidazole-5-carboxylate;bis(methyl 3-methylbenzimidazole-5-carboxylate) (CID 158454175) is methyl 3H-benzimidazole-5-carboxylate;bis(methyl 3-methylbenzimidazole-5-carboxylate).
What is the SMILES notation for methyl 3H-benzimidazole-5-carboxylate;bis(methyl 3-methylbenzimidazole-5-carboxylate)?
The canonical SMILES for methyl 3H-benzimidazole-5-carboxylate;bis(methyl 3-methylbenzimidazole-5-carboxylate) is COC(=O)c1ccc2nc[nH]c2c1.COC(=O)c1ccc2ncn(C)c2c1.COC(=O)c1ccc2ncn(C)c2c1.
What is the InChIKey of methyl 3H-benzimidazole-5-carboxylate;bis(methyl 3-methylbenzimidazole-5-carboxylate)?
The InChIKey is HEJDMQKDFTZHHR-UHFFFAOYSA-N. The full InChI is InChI=1S/2C10H10N2O2.C9H8N2O2/c2*1-12-6-11-8-4-3-7(5-9(8)12)10(13)14-2;1-13-9(12)6-2-3-7-8(4-6)11-5-10-7/h2*3-6H,1-2H3;2-5H,1H3,(H,10,11).
What are the key properties of methyl 3H-benzimidazole-5-carboxylate;bis(methyl 3-methylbenzimidazole-5-carboxylate)?
methyl 3H-benzimidazole-5-carboxylate;bis(methyl 3-methylbenzimidazole-5-carboxylate) has a molecular weight of 556.58 g/mol, XLogP of 4.07, 3 rotatable bonds, 1 hydrogen bond donors, and 11 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 3H-benzimidazole-5-carboxylate;bis(methyl 3-methylbenzimidazole-5-carboxylate) is sourced from PubChem (CID 158454175), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).