C11H12N2O2 — CID 121006340
methyl 1,6-dimethylbenzimidazole-5-carboxylate (PubChem CID 121006340) has the molecular formula C11H12N2O2 and a molecular weight of 204.23 g/mol. Its IUPAC name is methyl 1,6-dimethylbenzimidazole-5-carboxylate.
| Compound Name | methyl 1,6-dimethylbenzimidazole-5-carboxylate |
|---|---|
| PubChem CID | 121006340 |
| Molecular Formula | C11H12N2O2 |
| Molecular Weight | 204.23 g/mol |
| Exact Mass | 204.09 |
| IUPAC Name | methyl 1,6-dimethylbenzimidazole-5-carboxylate |
| SMILES | COC(=O)c1cc2ncn(C)c2cc1C |
| InChI | InChI=1S/C11H12N2O2/c1-7-4-10-9(12-6-13(10)2)5-8(7)11(14)15-3/h4-6H,1-3H3 |
| InChIKey | FRIONYLYWAOROA-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 44.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.23 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |