C42H48N4O4 — CID 158460534
N-hydroxy-5-(3-propan-2-ylphenyl)pyridine-2-carboxamide;N-[(2-methylpropan-2-yl)oxy]-N-(2-phenylethyl)-5-(3-propan-2-ylphenyl)pyridine-2-carboxamide (PubChem CID 158460534) has the molecular formula C42H48N4O4 and a molecular weight of 672.87 g/mol. Its IUPAC name is N-hydroxy-5-(3-propan-2-ylphenyl)pyridine-2-carboxamide;N-[(2-methylpropan-2-yl)oxy]-N-(2-phenylethyl)-5-(3-propan-2-ylphenyl)pyridine-2-carboxamide.
| Compound Name | N-hydroxy-5-(3-propan-2-ylphenyl)pyridine-2-carboxamide;N-[(2-methylpropan-2-yl)oxy]-N-(2-phenylethyl)-5-(3-propan-2-ylphenyl)pyridine-2-carboxamide |
|---|---|
| PubChem CID | 158460534 |
| Molecular Formula | C42H48N4O4 |
| Molecular Weight | 672.87 g/mol |
| Exact Mass | 672.37 |
| IUPAC Name | N-hydroxy-5-(3-propan-2-ylphenyl)pyridine-2-carboxamide;N-[(2-methylpropan-2-yl)oxy]-N-(2-phenylethyl)-5-(3-propan-2-ylphenyl)pyridine-2-carboxamide |
| SMILES | CC(C)c1cccc(-c2ccc(C(=O)N(CCc3ccccc3)OC(C)(C)C)nc2)c1.CC(C)c1cccc(-c2ccc(C(=O)NO)nc2)c1 |
| InChI | InChI=1S/C27H32N2O2.C15H16N2O2/c1-20(2)22-12-9-13-23(18-22)24-14-15-25(28-19-24)26(30)29(31-27(3,4)5)17-16-21-10-7-6-8-11-21;1-10(2)11-4-3-5-12(8-11)13-6-7-14(16-9-13)15(18)17-19/h6-15,18-20H,16-17H2,1-5H3;3-10,19H,1-2H3,(H,17,18) |
| InChIKey | HFCONLADVYOOHJ-UHFFFAOYSA-N |
| XLogP | 9.28 |
| TPSA | 104.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 672.87 |
| LogP ≤ 5 | 9.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|