C28H29N3O2 — CID 90924127
[[[3-(4-phenylphenyl)phenyl]-(1H-pyrazol-4-yl)methyl]amino] 3,3-dimethylbutanoate (PubChem CID 90924127) has the molecular formula C28H29N3O2 and a molecular weight of 439.56 g/mol. Its IUPAC name is [[[3-(4-phenylphenyl)phenyl]-(1H-pyrazol-4-yl)methyl]amino] 3,3-dimethylbutanoate.
| Compound Name | [[[3-(4-phenylphenyl)phenyl]-(1H-pyrazol-4-yl)methyl]amino] 3,3-dimethylbutanoate |
|---|---|
| PubChem CID | 90924127 |
| Molecular Formula | C28H29N3O2 |
| Molecular Weight | 439.56 g/mol |
| Exact Mass | 439.23 |
| IUPAC Name | [[[3-(4-phenylphenyl)phenyl]-(1H-pyrazol-4-yl)methyl]amino] 3,3-dimethylbutanoate |
| SMILES | CC(C)(C)CC(=O)ONC(c1cn[nH]c1)c1cccc(-c2ccc(-c3ccccc3)cc2)c1 |
| InChI | InChI=1S/C28H29N3O2/c1-28(2,3)17-26(32)33-31-27(25-18-29-30-19-25)24-11-7-10-23(16-24)22-14-12-21(13-15-22)20-8-5-4-6-9-20/h4-16,18-19,27,31H,17H2,1-3H3,(H,29,30) |
| InChIKey | CVIUBOIBRNRTKL-UHFFFAOYSA-N |
| XLogP | 6.32 |
| TPSA | 67.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.56 |
| LogP ≤ 5 | 6.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|