C36H40O4 — CID 158467095
1-[4-(4-ethylphenoxy)-2,6-dimethylphenyl]ethanone (PubChem CID 158467095) has the molecular formula C36H40O4 and a molecular weight of 536.71 g/mol. Its IUPAC name is 1-[4-(4-ethylphenoxy)-2,6-dimethylphenyl]ethanone.
| Compound Name | 1-[4-(4-ethylphenoxy)-2,6-dimethylphenyl]ethanone |
|---|---|
| PubChem CID | 158467095 |
| Molecular Formula | C36H40O4 |
| Molecular Weight | 536.71 g/mol |
| Exact Mass | 536.29 |
| IUPAC Name | 1-[4-(4-ethylphenoxy)-2,6-dimethylphenyl]ethanone |
| SMILES | CCc1ccc(Oc2cc(C)c(C(C)=O)c(C)c2)cc1.CCc1ccc(Oc2cc(C)c(C(C)=O)c(C)c2)cc1 |
| InChI | InChI=1S/2C18H20O2/c2*1-5-15-6-8-16(9-7-15)20-17-10-12(2)18(14(4)19)13(3)11-17/h2*6-11H,5H2,1-4H3 |
| InChIKey | HFWSTFIQJJJHFE-UHFFFAOYSA-N |
| XLogP | 9.72 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.71 |
| LogP ≤ 5 | 9.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |