C20H19NO4 — CID 158468620
ethyl 2-[2-(4-oxo-3,5-dihydro-1-benzazepin-2-yl)phenoxy]acetate (PubChem CID 158468620) has the molecular formula C20H19NO4 and a molecular weight of 337.38 g/mol. Its IUPAC name is ethyl 2-[2-(4-oxo-3,5-dihydro-1-benzazepin-2-yl)phenoxy]acetate.
| Compound Name | ethyl 2-[2-(4-oxo-3,5-dihydro-1-benzazepin-2-yl)phenoxy]acetate |
|---|---|
| PubChem CID | 158468620 |
| Molecular Formula | C20H19NO4 |
| Molecular Weight | 337.38 g/mol |
| Exact Mass | 337.13 |
| IUPAC Name | ethyl 2-[2-(4-oxo-3,5-dihydro-1-benzazepin-2-yl)phenoxy]acetate |
| SMILES | CCOC(=O)COc1ccccc1C1=Nc2ccccc2CC(=O)C1 |
| InChI | InChI=1S/C20H19NO4/c1-2-24-20(23)13-25-19-10-6-4-8-16(19)18-12-15(22)11-14-7-3-5-9-17(14)21-18/h3-10H,2,11-13H2,1H3 |
| InChIKey | FVJGFCURBKCLMJ-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 64.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.38 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |