C55H56F6OP2 — CID 158471486
benzyl-bis[3-methyl-5-(trifluoromethyl)phenyl]phosphane;benzyl-tert-butyl-(3,5-dimethylphenyl)phosphane;1-methyl-2-phenoxybenzene (PubChem CID 158471486) has the molecular formula C55H56F6OP2 and a molecular weight of 908.99 g/mol. Its IUPAC name is benzyl-bis[3-methyl-5-(trifluoromethyl)phenyl]phosphane;benzyl-tert-butyl-(3,5-dimethylphenyl)phosphane;1-methyl-2-phenoxybenzene.
| Compound Name | benzyl-bis[3-methyl-5-(trifluoromethyl)phenyl]phosphane;benzyl-tert-butyl-(3,5-dimethylphenyl)phosphane;1-methyl-2-phenoxybenzene |
|---|---|
| PubChem CID | 158471486 |
| Molecular Formula | C55H56F6OP2 |
| Molecular Weight | 908.99 g/mol |
| Exact Mass | 908.37 |
| IUPAC Name | benzyl-bis[3-methyl-5-(trifluoromethyl)phenyl]phosphane;benzyl-tert-butyl-(3,5-dimethylphenyl)phosphane;1-methyl-2-phenoxybenzene |
| SMILES | Cc1cc(C)cc(P(Cc2ccccc2)C(C)(C)C)c1.Cc1cc(P(Cc2ccccc2)c2cc(C)cc(C(F)(F)F)c2)cc(C(F)(F)F)c1.Cc1ccccc1Oc1ccccc1 |
| InChI | InChI=1S/C23H19F6P.C19H25P.C13H12O/c1-15-8-18(22(24,25)26)12-20(10-15)30(14-17-6-4-3-5-7-17)21-11-16(2)9-19(13-21)23(27,28)29;1-15-11-16(2)13-18(12-15)20(19(3,4)5)14-17-9-7-6-8-10-17;1-11-7-5-6-10-13(11)14-12-8-3-2-4-9-12/h3-13H,14H2,1-2H3;6-13H,14H2,1-5H3;2-10H,1H3 |
| InChIKey | HGKBFGLDABTRMB-UHFFFAOYSA-N |
| XLogP | 16.17 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 64 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 908.99 |
| LogP ≤ 5 | 16.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|