About 6-nitro-1-propylquinolin-2-one;1-propylquinolin-2-one
6-nitro-1-propylquinolin-2-one;1-propylquinolin-2-one (PubChem CID 158476838) has the molecular formula C24H25N3O4
and a molecular weight of 419.48 g/mol. Its IUPAC name is 6-nitro-1-propylquinolin-2-one;1-propylquinolin-2-one.
Molecular Properties
| Compound Name | 6-nitro-1-propylquinolin-2-one;1-propylquinolin-2-one |
| PubChem CID | 158476838 |
| Molecular Formula | C24H25N3O4 |
| Molecular Weight | 419.48 g/mol |
| Exact Mass | 419.18 |
| IUPAC Name | 6-nitro-1-propylquinolin-2-one;1-propylquinolin-2-one |
| SMILES | CCCn1c(=O)ccc2cc([N+](=O)[O-])ccc21.CCCn1c(=O)ccc2ccccc21 |
| InChI | InChI=1S/C12H12N2O3.C12H13NO/c1-2-7-13-11-5-4-10(14(16)17)8-9(11)3-6-12(13)15;1-2-9-13-11-6-4-3-5-10(11)7-8-12(13)14/h3-6,8H,2,7H2,1H3;3-8H,2,9H2,1H3 |
| InChIKey | HHAVDODDSPTQLC-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 87.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 419.48 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 6-nitro-1-propylquinolin-2-one;1-propylquinolin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-nitro-1-propylquinolin-2-one;1-propylquinolin-2-one?
The IUPAC name of 6-nitro-1-propylquinolin-2-one;1-propylquinolin-2-one (CID 158476838) is 6-nitro-1-propylquinolin-2-one;1-propylquinolin-2-one.
What is the SMILES notation for 6-nitro-1-propylquinolin-2-one;1-propylquinolin-2-one?
The canonical SMILES for 6-nitro-1-propylquinolin-2-one;1-propylquinolin-2-one is CCCn1c(=O)ccc2cc([N+](=O)[O-])ccc21.CCCn1c(=O)ccc2ccccc21.
What is the InChIKey of 6-nitro-1-propylquinolin-2-one;1-propylquinolin-2-one?
The InChIKey is HHAVDODDSPTQLC-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H12N2O3.C12H13NO/c1-2-7-13-11-5-4-10(14(16)17)8-9(11)3-6-12(13)15;1-2-9-13-11-6-4-3-5-10(11)7-8-12(13)14/h3-6,8H,2,7H2,1H3;3-8H,2,9H2,1H3.
What are the key properties of 6-nitro-1-propylquinolin-2-one;1-propylquinolin-2-one?
6-nitro-1-propylquinolin-2-one;1-propylquinolin-2-one has a molecular weight of 419.48 g/mol, XLogP of 4.73, 5 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 6-nitro-1-propylquinolin-2-one;1-propylquinolin-2-one is sourced from PubChem (CID 158476838), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).