C25H30N6OS — CID 158476968
(7S)-N,N-dimethyl-4-[[6-[methyl(propan-2-yl)amino]-1H-isoindol-5-yl]amino]-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidine-7-carboxamide (PubChem CID 158476968) has the molecular formula C25H30N6OS and a molecular weight of 462.62 g/mol. Its IUPAC name is (7S)-N,N-dimethyl-4-[[6-[methyl(propan-2-yl)amino]-1H-isoindol-5-yl]amino]-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidine-7-carboxamide.
| Compound Name | (7S)-N,N-dimethyl-4-[[6-[methyl(propan-2-yl)amino]-1H-isoindol-5-yl]amino]-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidine-7-carboxamide |
|---|---|
| PubChem CID | 158476968 |
| Molecular Formula | C25H30N6OS |
| Molecular Weight | 462.62 g/mol |
| Exact Mass | 462.22 |
| IUPAC Name | (7S)-N,N-dimethyl-4-[[6-[methyl(propan-2-yl)amino]-1H-isoindol-5-yl]amino]-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidine-7-carboxamide |
| SMILES | CC(C)N(C)c1cc2c(cc1Nc1ncnc3sc4c(c13)CC[C@H](C(=O)N(C)C)C4)C=NC2 |
| InChI | InChI=1S/C25H30N6OS/c1-14(2)31(5)20-9-17-12-26-11-16(17)8-19(20)29-23-22-18-7-6-15(25(32)30(3)4)10-21(18)33-24(22)28-13-27-23/h8-9,11,13-15H,6-7,10,12H2,1-5H3,(H,27,28,29)/t15-/m0/s1 |
| InChIKey | HRYMBEUNBGKFMF-HNNXBMFYSA-N |
| XLogP | 4.41 |
| TPSA | 73.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.62 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |