C18H17BrFNO4S — CID 158482888
N-(3-bromo-4-fluorophenyl)-3-[(3-methyloxetan-3-yl)methylsulfonyl]benzamide (PubChem CID 158482888) has the molecular formula C18H17BrFNO4S and a molecular weight of 442.31 g/mol. Its IUPAC name is N-(3-bromo-4-fluorophenyl)-3-[(3-methyloxetan-3-yl)methylsulfonyl]benzamide.
| Compound Name | N-(3-bromo-4-fluorophenyl)-3-[(3-methyloxetan-3-yl)methylsulfonyl]benzamide |
|---|---|
| PubChem CID | 158482888 |
| Molecular Formula | C18H17BrFNO4S |
| Molecular Weight | 442.31 g/mol |
| Exact Mass | 441.00 |
| IUPAC Name | N-(3-bromo-4-fluorophenyl)-3-[(3-methyloxetan-3-yl)methylsulfonyl]benzamide |
| SMILES | CC1(CS(=O)(=O)c2cccc(C(=O)Nc3ccc(F)c(Br)c3)c2)COC1 |
| InChI | InChI=1S/C18H17BrFNO4S/c1-18(9-25-10-18)11-26(23,24)14-4-2-3-12(7-14)17(22)21-13-5-6-16(20)15(19)8-13/h2-8H,9-11H2,1H3,(H,21,22) |
| InChIKey | HHSVTZPSETWLSQ-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.31 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |