C11H13NO — CID 158486527
4-methyl-7-(methylamino)-2,3-dihydroinden-1-one (PubChem CID 158486527) has the molecular formula C11H13NO and a molecular weight of 175.23 g/mol. Its IUPAC name is 4-methyl-7-(methylamino)-2,3-dihydroinden-1-one.
| Compound Name | 4-methyl-7-(methylamino)-2,3-dihydroinden-1-one |
|---|---|
| PubChem CID | 158486527 |
| Molecular Formula | C11H13NO |
| Molecular Weight | 175.23 g/mol |
| Exact Mass | 175.10 |
| IUPAC Name | 4-methyl-7-(methylamino)-2,3-dihydroinden-1-one |
| SMILES | CNc1ccc(C)c2c1C(=O)CC2 |
| InChI | InChI=1S/C11H13NO/c1-7-3-5-9(12-2)11-8(7)4-6-10(11)13/h3,5,12H,4,6H2,1-2H3 |
| InChIKey | DMQQRFFZWQTVTL-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 175.23 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |