C19H17NO — CID 23433462
2,2,4-trimethyl-1H-indeno[1,2-g]quinolin-10-one (PubChem CID 23433462) has the molecular formula C19H17NO and a molecular weight of 275.35 g/mol. Its IUPAC name is 2,2,4-trimethyl-1H-indeno[1,2-g]quinolin-10-one.
| Compound Name | 2,2,4-trimethyl-1H-indeno[1,2-g]quinolin-10-one |
|---|---|
| PubChem CID | 23433462 |
| Molecular Formula | C19H17NO |
| Molecular Weight | 275.35 g/mol |
| Exact Mass | 275.13 |
| IUPAC Name | 2,2,4-trimethyl-1H-indeno[1,2-g]quinolin-10-one |
| SMILES | CC1=CC(C)(C)Nc2cc3c(cc21)-c1ccccc1C3=O |
| InChI | InChI=1S/C19H17NO/c1-11-10-19(2,3)20-17-9-16-15(8-14(11)17)12-6-4-5-7-13(12)18(16)21/h4-10,20H,1-3H3 |
| InChIKey | WLCNSVBDDHMXCH-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.35 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |