C27H37N3O5S2 — CID 158488836
(2S)-4-oxo-4-[3-[2-(5,6,7,8-tetrahydroquinolin-2-yl)ethyl]azetidin-1-yl]-2-[(2,4,6-trimethylphenyl)sulfonylamino]butanoic acid;sulfane (PubChem CID 158488836) has the molecular formula C27H37N3O5S2 and a molecular weight of 547.74 g/mol. Its IUPAC name is (2S)-4-oxo-4-[3-[2-(5,6,7,8-tetrahydroquinolin-2-yl)ethyl]azetidin-1-yl]-2-[(2,4,6-trimethylphenyl)sulfonylamino]butanoic acid;sulfane.
| Compound Name | (2S)-4-oxo-4-[3-[2-(5,6,7,8-tetrahydroquinolin-2-yl)ethyl]azetidin-1-yl]-2-[(2,4,6-trimethylphenyl)sulfonylamino]butanoic acid;sulfane |
|---|---|
| PubChem CID | 158488836 |
| Molecular Formula | C27H37N3O5S2 |
| Molecular Weight | 547.74 g/mol |
| Exact Mass | 547.22 |
| IUPAC Name | (2S)-4-oxo-4-[3-[2-(5,6,7,8-tetrahydroquinolin-2-yl)ethyl]azetidin-1-yl]-2-[(2,4,6-trimethylphenyl)sulfonylamino]butanoic acid;sulfane |
| SMILES | Cc1cc(C)c(S(=O)(=O)N[C@@H](CC(=O)N2CC(CCc3ccc4c(n3)CCCC4)C2)C(=O)O)c(C)c1.S |
| InChI | InChI=1S/C27H35N3O5S.H2S/c1-17-12-18(2)26(19(3)13-17)36(34,35)29-24(27(32)33)14-25(31)30-15-20(16-30)8-10-22-11-9-21-6-4-5-7-23(21)28-22;/h9,11-13,20,24,29H,4-8,10,14-16H2,1-3H3,(H,32,33);1H2/t24-;/m0./s1 |
| InChIKey | HILDVMJVVHWARY-JIDHJSLPSA-N |
| XLogP | 3.21 |
| TPSA | 116.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.74 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |