C25H23F3N8O4 — CID 158489022
6-fluoro-2-methyl-1H-benzimidazole;5-fluoro-2-methyl-4-nitro-1H-benzimidazole;5-fluoro-2-methyl-6-nitro-1H-benzimidazole;methane (PubChem CID 158489022) has the molecular formula C25H23F3N8O4 and a molecular weight of 556.51 g/mol. Its IUPAC name is 6-fluoro-2-methyl-1H-benzimidazole;5-fluoro-2-methyl-4-nitro-1H-benzimidazole;5-fluoro-2-methyl-6-nitro-1H-benzimidazole;methane.
| Compound Name | 6-fluoro-2-methyl-1H-benzimidazole;5-fluoro-2-methyl-4-nitro-1H-benzimidazole;5-fluoro-2-methyl-6-nitro-1H-benzimidazole;methane |
|---|---|
| PubChem CID | 158489022 |
| Molecular Formula | C25H23F3N8O4 |
| Molecular Weight | 556.51 g/mol |
| Exact Mass | 556.18 |
| IUPAC Name | 6-fluoro-2-methyl-1H-benzimidazole;5-fluoro-2-methyl-4-nitro-1H-benzimidazole;5-fluoro-2-methyl-6-nitro-1H-benzimidazole;methane |
| SMILES | C.Cc1nc2c([N+](=O)[O-])c(F)ccc2[nH]1.Cc1nc2cc(F)c([N+](=O)[O-])cc2[nH]1.Cc1nc2ccc(F)cc2[nH]1 |
| InChI | InChI=1S/2C8H6FN3O2.C8H7FN2.CH4/c1-4-10-6-2-5(9)8(12(13)14)3-7(6)11-4;1-4-10-6-3-2-5(9)8(12(13)14)7(6)11-4;1-5-10-7-3-2-6(9)4-8(7)11-5;/h2*2-3H,1H3,(H,10,11);2-4H,1H3,(H,10,11);1H4 |
| InChIKey | HILSHKSVFVRTFY-UHFFFAOYSA-N |
| XLogP | 6.48 |
| TPSA | 172.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.51 |
| LogP ≤ 5 | 6.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|