C40H58N6O6S2 — CID 158493919
1-(1,2,3,5,6,7-hexahydro-s-indacen-4-yl)-3-(2-piperidin-1-ylethylsulfonyl)urea;4-isocyanato-1,2,3,5,6,7-hexahydro-s-indacene;2-piperidin-1-ylethanesulfonamide (PubChem CID 158493919) has the molecular formula C40H58N6O6S2 and a molecular weight of 783.07 g/mol. Its IUPAC name is 1-(1,2,3,5,6,7-hexahydro-s-indacen-4-yl)-3-(2-piperidin-1-ylethylsulfonyl)urea;4-isocyanato-1,2,3,5,6,7-hexahydro-s-indacene;2-piperidin-1-ylethanesulfonamide.
| Compound Name | 1-(1,2,3,5,6,7-hexahydro-s-indacen-4-yl)-3-(2-piperidin-1-ylethylsulfonyl)urea;4-isocyanato-1,2,3,5,6,7-hexahydro-s-indacene;2-piperidin-1-ylethanesulfonamide |
|---|---|
| PubChem CID | 158493919 |
| Molecular Formula | C40H58N6O6S2 |
| Molecular Weight | 783.07 g/mol |
| Exact Mass | 782.39 |
| IUPAC Name | 1-(1,2,3,5,6,7-hexahydro-s-indacen-4-yl)-3-(2-piperidin-1-ylethylsulfonyl)urea;4-isocyanato-1,2,3,5,6,7-hexahydro-s-indacene;2-piperidin-1-ylethanesulfonamide |
| SMILES | NS(=O)(=O)CCN1CCCCC1.O=C(Nc1c2c(cc3c1CCC3)CCC2)NS(=O)(=O)CCN1CCCCC1.O=C=Nc1c2c(cc3c1CCC3)CCC2 |
| InChI | InChI=1S/C20H29N3O3S.C13H13NO.C7H16N2O2S/c24-20(22-27(25,26)13-12-23-10-2-1-3-11-23)21-19-17-8-4-6-15(17)14-16-7-5-9-18(16)19;15-8-14-13-11-5-1-3-9(11)7-10-4-2-6-12(10)13;8-12(10,11)7-6-9-4-2-1-3-5-9/h14H,1-13H2,(H2,21,22,24);7H,1-6H2;1-7H2,(H2,8,10,11) |
| InChIKey | HJASMLLALRGTIZ-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 171.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 54 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 783.07 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|