C34H50N6O6S2 — CID 159846697
2-(ethylamino)ethanesulfonamide;1-[2-(ethylamino)ethylsulfonyl]-3-(1,2,3,5,6,7-hexahydro-s-indacen-4-yl)urea;4-isocyanato-1,2,3,5,6,7-hexahydro-s-indacene (PubChem CID 159846697) has the molecular formula C34H50N6O6S2 and a molecular weight of 702.94 g/mol. Its IUPAC name is 2-(ethylamino)ethanesulfonamide;1-[2-(ethylamino)ethylsulfonyl]-3-(1,2,3,5,6,7-hexahydro-s-indacen-4-yl)urea;4-isocyanato-1,2,3,5,6,7-hexahydro-s-indacene.
| Compound Name | 2-(ethylamino)ethanesulfonamide;1-[2-(ethylamino)ethylsulfonyl]-3-(1,2,3,5,6,7-hexahydro-s-indacen-4-yl)urea;4-isocyanato-1,2,3,5,6,7-hexahydro-s-indacene |
|---|---|
| PubChem CID | 159846697 |
| Molecular Formula | C34H50N6O6S2 |
| Molecular Weight | 702.94 g/mol |
| Exact Mass | 702.32 |
| IUPAC Name | 2-(ethylamino)ethanesulfonamide;1-[2-(ethylamino)ethylsulfonyl]-3-(1,2,3,5,6,7-hexahydro-s-indacen-4-yl)urea;4-isocyanato-1,2,3,5,6,7-hexahydro-s-indacene |
| SMILES | CCNCCS(=O)(=O)NC(=O)Nc1c2c(cc3c1CCC3)CCC2.CCNCCS(N)(=O)=O.O=C=Nc1c2c(cc3c1CCC3)CCC2 |
| InChI | InChI=1S/C17H25N3O3S.C13H13NO.C4H12N2O2S/c1-2-18-9-10-24(22,23)20-17(21)19-16-14-7-3-5-12(14)11-13-6-4-8-15(13)16;15-8-14-13-11-5-1-3-9(11)7-10-4-2-6-12(10)13;1-2-6-3-4-9(5,7)8/h11,18H,2-10H2,1H3,(H2,19,20,21);7H,1-6H2;6H,2-4H2,1H3,(H2,5,7,8) |
| InChIKey | NPKBAGKUUTVPKE-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 188.92 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 48 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 702.94 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|