C13H9Cl2F3N2O2 — CID 158495790
6-chloropyridine-3-carbaldehyde;1-(6-chloro-3-pyridinyl)-2,2,2-trifluoroethanol (PubChem CID 158495790) has the molecular formula C13H9Cl2F3N2O2 and a molecular weight of 353.13 g/mol. Its IUPAC name is 6-chloropyridine-3-carbaldehyde;1-(6-chloro-3-pyridinyl)-2,2,2-trifluoroethanol.
| Compound Name | 6-chloropyridine-3-carbaldehyde;1-(6-chloro-3-pyridinyl)-2,2,2-trifluoroethanol |
|---|---|
| PubChem CID | 158495790 |
| Molecular Formula | C13H9Cl2F3N2O2 |
| Molecular Weight | 353.13 g/mol |
| Exact Mass | 352.00 |
| IUPAC Name | 6-chloropyridine-3-carbaldehyde;1-(6-chloro-3-pyridinyl)-2,2,2-trifluoroethanol |
| SMILES | O=Cc1ccc(Cl)nc1.OC(c1ccc(Cl)nc1)C(F)(F)F |
| InChI | InChI=1S/C7H5ClF3NO.C6H4ClNO/c8-5-2-1-4(3-12-5)6(13)7(9,10)11;7-6-2-1-5(4-9)3-8-6/h1-3,6,13H;1-4H |
| InChIKey | HJGPQSIEEAXUGS-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 63.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.13 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|