C25H36N6O4S — CID 158498341
N-[[4-[[(4-hydrazinylquinazolin-2-yl)amino]methyl]cyclohexyl]methyl]-2,5-dimethoxybenzenesulfonamide;methane (PubChem CID 158498341) has the molecular formula C25H36N6O4S and a molecular weight of 516.67 g/mol. Its IUPAC name is N-[[4-[[(4-hydrazinylquinazolin-2-yl)amino]methyl]cyclohexyl]methyl]-2,5-dimethoxybenzenesulfonamide;methane.
| Compound Name | N-[[4-[[(4-hydrazinylquinazolin-2-yl)amino]methyl]cyclohexyl]methyl]-2,5-dimethoxybenzenesulfonamide;methane |
|---|---|
| PubChem CID | 158498341 |
| Molecular Formula | C25H36N6O4S |
| Molecular Weight | 516.67 g/mol |
| Exact Mass | 516.25 |
| IUPAC Name | N-[[4-[[(4-hydrazinylquinazolin-2-yl)amino]methyl]cyclohexyl]methyl]-2,5-dimethoxybenzenesulfonamide;methane |
| SMILES | C.COc1ccc(OC)c(S(=O)(=O)NCC2CCC(CNc3nc(NN)c4ccccc4n3)CC2)c1 |
| InChI | InChI=1S/C24H32N6O4S.CH4/c1-33-18-11-12-21(34-2)22(13-18)35(31,32)27-15-17-9-7-16(8-10-17)14-26-24-28-20-6-4-3-5-19(20)23(29-24)30-25;/h3-6,11-13,16-17,27H,7-10,14-15,25H2,1-2H3,(H2,26,28,29,30);1H4 |
| InChIKey | HJONFXMRFNJBHL-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 140.49 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.67 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|