C24H31F3N6O3S — CID 159875689
N-[[4-[[(4-hydrazinylquinazolin-2-yl)amino]methyl]cyclohexyl]methyl]-4-(trifluoromethoxy)benzenesulfonamide;methane (PubChem CID 159875689) has the molecular formula C24H31F3N6O3S and a molecular weight of 540.61 g/mol. Its IUPAC name is N-[[4-[[(4-hydrazinylquinazolin-2-yl)amino]methyl]cyclohexyl]methyl]-4-(trifluoromethoxy)benzenesulfonamide;methane.
| Compound Name | N-[[4-[[(4-hydrazinylquinazolin-2-yl)amino]methyl]cyclohexyl]methyl]-4-(trifluoromethoxy)benzenesulfonamide;methane |
|---|---|
| PubChem CID | 159875689 |
| Molecular Formula | C24H31F3N6O3S |
| Molecular Weight | 540.61 g/mol |
| Exact Mass | 540.21 |
| IUPAC Name | N-[[4-[[(4-hydrazinylquinazolin-2-yl)amino]methyl]cyclohexyl]methyl]-4-(trifluoromethoxy)benzenesulfonamide;methane |
| SMILES | C.NNc1nc(NCC2CCC(CNS(=O)(=O)c3ccc(OC(F)(F)F)cc3)CC2)nc2ccccc12 |
| InChI | InChI=1S/C23H27F3N6O3S.CH4/c24-23(25,26)35-17-9-11-18(12-10-17)36(33,34)29-14-16-7-5-15(6-8-16)13-28-22-30-20-4-2-1-3-19(20)21(31-22)32-27;/h1-4,9-12,15-16,29H,5-8,13-14,27H2,(H2,28,30,31,32);1H4 |
| InChIKey | NSWLCQCKNFBHLC-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 131.26 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.61 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|