C33H35FN2O4S — CID 158499051
5-(dimethylamino)-N-[3-[3-[[5-(2-fluorophenyl)-2-methoxyphenyl]sulfonylmethyl]phenyl]propyl]-2-methylbenzamide (PubChem CID 158499051) has the molecular formula C33H35FN2O4S and a molecular weight of 574.72 g/mol. Its IUPAC name is 5-(dimethylamino)-N-[3-[3-[[5-(2-fluorophenyl)-2-methoxyphenyl]sulfonylmethyl]phenyl]propyl]-2-methylbenzamide.
| Compound Name | 5-(dimethylamino)-N-[3-[3-[[5-(2-fluorophenyl)-2-methoxyphenyl]sulfonylmethyl]phenyl]propyl]-2-methylbenzamide |
|---|---|
| PubChem CID | 158499051 |
| Molecular Formula | C33H35FN2O4S |
| Molecular Weight | 574.72 g/mol |
| Exact Mass | 574.23 |
| IUPAC Name | 5-(dimethylamino)-N-[3-[3-[[5-(2-fluorophenyl)-2-methoxyphenyl]sulfonylmethyl]phenyl]propyl]-2-methylbenzamide |
| SMILES | COc1ccc(-c2ccccc2F)cc1S(=O)(=O)Cc1cccc(CCCNC(=O)c2cc(N(C)C)ccc2C)c1 |
| InChI | InChI=1S/C33H35FN2O4S/c1-23-14-16-27(36(2)3)21-29(23)33(37)35-18-8-11-24-9-7-10-25(19-24)22-41(38,39)32-20-26(15-17-31(32)40-4)28-12-5-6-13-30(28)34/h5-7,9-10,12-17,19-21H,8,11,18,22H2,1-4H3,(H,35,37) |
| InChIKey | HJQUSRKMGCZJJK-UHFFFAOYSA-N |
| XLogP | 6.21 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.72 |
| LogP ≤ 5 | 6.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|