C39H54O4S — CID 158500659
(2S,4R,5R)-2,3,4,5-tetramethyl-6-(phenylmethoxymethyl)oxane;(3S,4S,6S)-3,4,5-trimethyl-2-(phenylmethoxymethyl)-6-phenylsulfanyloxane (PubChem CID 158500659) has the molecular formula C39H54O4S and a molecular weight of 618.92 g/mol. Its IUPAC name is (2S,4R,5R)-2,3,4,5-tetramethyl-6-(phenylmethoxymethyl)oxane;(3S,4S,6S)-3,4,5-trimethyl-2-(phenylmethoxymethyl)-6-phenylsulfanyloxane.
| Compound Name | (2S,4R,5R)-2,3,4,5-tetramethyl-6-(phenylmethoxymethyl)oxane;(3S,4S,6S)-3,4,5-trimethyl-2-(phenylmethoxymethyl)-6-phenylsulfanyloxane |
|---|---|
| PubChem CID | 158500659 |
| Molecular Formula | C39H54O4S |
| Molecular Weight | 618.92 g/mol |
| Exact Mass | 618.37 |
| IUPAC Name | (2S,4R,5R)-2,3,4,5-tetramethyl-6-(phenylmethoxymethyl)oxane;(3S,4S,6S)-3,4,5-trimethyl-2-(phenylmethoxymethyl)-6-phenylsulfanyloxane |
| SMILES | CC1[C@@H](C)[C@H](C)C(COCc2ccccc2)O[C@H]1Sc1ccccc1.CC1[C@H](C)OC(COCc2ccccc2)[C@H](C)[C@@H]1C |
| InChI | InChI=1S/C22H28O2S.C17H26O2/c1-16-17(2)21(15-23-14-19-10-6-4-7-11-19)24-22(18(16)3)25-20-12-8-5-9-13-20;1-12-13(2)15(4)19-17(14(12)3)11-18-10-16-8-6-5-7-9-16/h4-13,16-18,21-22H,14-15H2,1-3H3;5-9,12-15,17H,10-11H2,1-4H3/t16-,17-,18?,21?,22-;12-,13?,14-,15+,17?/m01/s1 |
| InChIKey | HJVSLXUOLUXJNU-CEGGTDAQSA-N |
| XLogP | 9.53 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 618.92 |
| LogP ≤ 5 | 9.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |