C21H22FN5O5 — CID 158504815
ethyl 3-[4-fluoro-2-[1-(3-nitropyrazolo[1,5-a]pyrimidin-5-yl)pyrrolidin-2-yl]phenoxy]propanoate (PubChem CID 158504815) has the molecular formula C21H22FN5O5 and a molecular weight of 443.44 g/mol. Its IUPAC name is ethyl 3-[4-fluoro-2-[1-(3-nitropyrazolo[1,5-a]pyrimidin-5-yl)pyrrolidin-2-yl]phenoxy]propanoate.
| Compound Name | ethyl 3-[4-fluoro-2-[1-(3-nitropyrazolo[1,5-a]pyrimidin-5-yl)pyrrolidin-2-yl]phenoxy]propanoate |
|---|---|
| PubChem CID | 158504815 |
| Molecular Formula | C21H22FN5O5 |
| Molecular Weight | 443.44 g/mol |
| Exact Mass | 443.16 |
| IUPAC Name | ethyl 3-[4-fluoro-2-[1-(3-nitropyrazolo[1,5-a]pyrimidin-5-yl)pyrrolidin-2-yl]phenoxy]propanoate |
| SMILES | CCOC(=O)CCOc1ccc(F)cc1C1CCCN1c1ccn2ncc([N+](=O)[O-])c2n1 |
| InChI | InChI=1S/C21H22FN5O5/c1-2-31-20(28)8-11-32-18-6-5-14(22)12-15(18)16-4-3-9-25(16)19-7-10-26-21(24-19)17(13-23-26)27(29)30/h5-7,10,12-13,16H,2-4,8-9,11H2,1H3 |
| InChIKey | AKWCUFALMAINFJ-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 112.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.44 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|