C31H52O3 — CID 15850499
(1S,2S,3R,9S,10R,13R,14R,17R)-2-(4-hydroxybutyl)-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-2,3,4,9,11,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthrene-1,3-diol (PubChem CID 15850499) has the molecular formula C31H52O3 and a molecular weight of 472.75 g/mol. Its IUPAC name is (1S,2S,3R,9S,10R,13R,14R,17R)-2-(4-hydroxybutyl)-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-2,3,4,9,11,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthrene-1,3-diol.
| Compound Name | (1S,2S,3R,9S,10R,13R,14R,17R)-2-(4-hydroxybutyl)-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-2,3,4,9,11,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthrene-1,3-diol |
|---|---|
| PubChem CID | 15850499 |
| Molecular Formula | C31H52O3 |
| Molecular Weight | 472.75 g/mol |
| Exact Mass | 472.39 |
| IUPAC Name | (1S,2S,3R,9S,10R,13R,14R,17R)-2-(4-hydroxybutyl)-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-2,3,4,9,11,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthrene-1,3-diol |
| SMILES | CC(C)CCC[C@@H](C)[C@H]1CC[C@H]2C3=CC=C4C[C@@H](O)[C@H](CCCCO)[C@H](O)[C@]4(C)[C@H]3CC[C@]12C |
| InChI | InChI=1S/C31H52O3/c1-20(2)9-8-10-21(3)25-14-15-26-23-13-12-22-19-28(33)24(11-6-7-18-32)29(34)31(22,5)27(23)16-17-30(25,26)4/h12-13,20-21,24-29,32-34H,6-11,14-19H2,1-5H3/t21-,24+,25-,26+,27+,28-,29+,30-,31+/m1/s1 |
| InChIKey | QITNLBLCGOGRTG-PJBIOMEFSA-N |
| XLogP | 6.67 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.75 |
| LogP ≤ 5 | 6.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|