C33H56O3 — CID 54317072
(1S,2R,3R,9S,10R,13R,14R,17R)-2-(6-hydroxyhexyl)-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-2,3,4,9,11,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthrene-1,3-diol (PubChem CID 54317072) has the molecular formula C33H56O3 and a molecular weight of 500.81 g/mol. Its IUPAC name is (1S,2R,3R,9S,10R,13R,14R,17R)-2-(6-hydroxyhexyl)-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-2,3,4,9,11,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthrene-1,3-diol.
| Compound Name | (1S,2R,3R,9S,10R,13R,14R,17R)-2-(6-hydroxyhexyl)-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-2,3,4,9,11,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthrene-1,3-diol |
|---|---|
| PubChem CID | 54317072 |
| Molecular Formula | C33H56O3 |
| Molecular Weight | 500.81 g/mol |
| Exact Mass | 500.42 |
| IUPAC Name | (1S,2R,3R,9S,10R,13R,14R,17R)-2-(6-hydroxyhexyl)-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-2,3,4,9,11,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthrene-1,3-diol |
| SMILES | CC(C)CCC[C@@H](C)[C@H]1CC[C@H]2C3=CC=C4C[C@@H](O)[C@@H](CCCCCCO)[C@H](O)[C@]4(C)[C@H]3CC[C@]12C |
| InChI | InChI=1S/C33H56O3/c1-22(2)11-10-12-23(3)27-16-17-28-25-15-14-24-21-30(35)26(13-8-6-7-9-20-34)31(36)33(24,5)29(25)18-19-32(27,28)4/h14-15,22-23,26-31,34-36H,6-13,16-21H2,1-5H3/t23-,26-,27-,28+,29+,30-,31+,32-,33+/m1/s1 |
| InChIKey | SOYZESANAJORPS-HDGMAESCSA-N |
| XLogP | 7.45 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.81 |
| LogP ≤ 5 | 7.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|