About 4-[hydroxy(methyl)phosphoryl]-2-oxobutanoic acid;molecular iodine
4-[hydroxy(methyl)phosphoryl]-2-oxobutanoic acid;molecular iodine (PubChem CID 158506302) has the molecular formula C5H9I2O5P
and a molecular weight of 433.90 g/mol. Its IUPAC name is 4-[hydroxy(methyl)phosphoryl]-2-oxobutanoic acid;molecular iodine.
Molecular Properties
| Compound Name | 4-[hydroxy(methyl)phosphoryl]-2-oxobutanoic acid;molecular iodine |
| PubChem CID | 158506302 |
| Molecular Formula | C5H9I2O5P |
| Molecular Weight | 433.90 g/mol |
| Exact Mass | 433.83 |
| IUPAC Name | 4-[hydroxy(methyl)phosphoryl]-2-oxobutanoic acid;molecular iodine |
| SMILES | CP(=O)(O)CCC(=O)C(=O)O.II |
| InChI | InChI=1S/C5H9O5P.I2/c1-11(9,10)3-2-4(6)5(7)8;1-2/h2-3H2,1H3,(H,7,8)(H,9,10); |
| InChIKey | HKMSMWFIZSWOFP-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 91.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 433.90 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 4-[hydroxy(methyl)phosphoryl]-2-oxobutanoic acid;molecular iodine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[hydroxy(methyl)phosphoryl]-2-oxobutanoic acid;molecular iodine?
The IUPAC name of 4-[hydroxy(methyl)phosphoryl]-2-oxobutanoic acid;molecular iodine (CID 158506302) is 4-[hydroxy(methyl)phosphoryl]-2-oxobutanoic acid;molecular iodine.
What is the SMILES notation for 4-[hydroxy(methyl)phosphoryl]-2-oxobutanoic acid;molecular iodine?
The canonical SMILES for 4-[hydroxy(methyl)phosphoryl]-2-oxobutanoic acid;molecular iodine is CP(=O)(O)CCC(=O)C(=O)O.II.
What is the InChIKey of 4-[hydroxy(methyl)phosphoryl]-2-oxobutanoic acid;molecular iodine?
The InChIKey is HKMSMWFIZSWOFP-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H9O5P.I2/c1-11(9,10)3-2-4(6)5(7)8;1-2/h2-3H2,1H3,(H,7,8)(H,9,10);.
What are the key properties of 4-[hydroxy(methyl)phosphoryl]-2-oxobutanoic acid;molecular iodine?
4-[hydroxy(methyl)phosphoryl]-2-oxobutanoic acid;molecular iodine has a molecular weight of 433.90 g/mol, XLogP of 1.70, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[hydroxy(methyl)phosphoryl]-2-oxobutanoic acid;molecular iodine is sourced from PubChem (CID 158506302), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).