C9H17O5P — CID 58609437
6-[hydroxy(methyl)phosphoryl]-2,3-dimethyl-4-oxohexanoic acid (PubChem CID 58609437) has the molecular formula C9H17O5P and a molecular weight of 236.20 g/mol. Its IUPAC name is 6-[hydroxy(methyl)phosphoryl]-2,3-dimethyl-4-oxohexanoic acid.
| Compound Name | 6-[hydroxy(methyl)phosphoryl]-2,3-dimethyl-4-oxohexanoic acid |
|---|---|
| PubChem CID | 58609437 |
| Molecular Formula | C9H17O5P |
| Molecular Weight | 236.20 g/mol |
| Exact Mass | 236.08 |
| IUPAC Name | 6-[hydroxy(methyl)phosphoryl]-2,3-dimethyl-4-oxohexanoic acid |
| SMILES | CC(C(=O)O)C(C)C(=O)CCP(C)(=O)O |
| InChI | InChI=1S/C9H17O5P/c1-6(7(2)9(11)12)8(10)4-5-15(3,13)14/h6-7H,4-5H2,1-3H3,(H,11,12)(H,13,14) |
| InChIKey | BNBVMXUKVHQTFF-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 91.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.20 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|