C24H33N5O3 — CID 158506418
4-amino-2-butoxy-9-[[3-(morpholin-4-ylmethyl)phenyl]methyl]-7,8-dihydro-5H-pyrimido[4,5-b]azepin-6-one (PubChem CID 158506418) has the molecular formula C24H33N5O3 and a molecular weight of 439.56 g/mol. Its IUPAC name is 4-amino-2-butoxy-9-[[3-(morpholin-4-ylmethyl)phenyl]methyl]-7,8-dihydro-5H-pyrimido[4,5-b]azepin-6-one.
| Compound Name | 4-amino-2-butoxy-9-[[3-(morpholin-4-ylmethyl)phenyl]methyl]-7,8-dihydro-5H-pyrimido[4,5-b]azepin-6-one |
|---|---|
| PubChem CID | 158506418 |
| Molecular Formula | C24H33N5O3 |
| Molecular Weight | 439.56 g/mol |
| Exact Mass | 439.26 |
| IUPAC Name | 4-amino-2-butoxy-9-[[3-(morpholin-4-ylmethyl)phenyl]methyl]-7,8-dihydro-5H-pyrimido[4,5-b]azepin-6-one |
| SMILES | CCCCOc1nc(N)c2c(n1)N(Cc1cccc(CN3CCOCC3)c1)CCC(=O)C2 |
| InChI | InChI=1S/C24H33N5O3/c1-2-3-11-32-24-26-22(25)21-15-20(30)7-8-29(23(21)27-24)17-19-6-4-5-18(14-19)16-28-9-12-31-13-10-28/h4-6,14H,2-3,7-13,15-17H2,1H3,(H2,25,26,27) |
| InChIKey | CUSRRPQNTAIFPI-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 93.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.56 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|