C13H12Br4N2 — CID 158506883
3,4-dibromoaniline;3,4-dibromo-N-methylaniline (PubChem CID 158506883) has the molecular formula C13H12Br4N2 and a molecular weight of 515.87 g/mol. Its IUPAC name is 3,4-dibromoaniline;3,4-dibromo-N-methylaniline.
| Compound Name | 3,4-dibromoaniline;3,4-dibromo-N-methylaniline |
|---|---|
| PubChem CID | 158506883 |
| Molecular Formula | C13H12Br4N2 |
| Molecular Weight | 515.87 g/mol |
| Exact Mass | 511.77 |
| IUPAC Name | 3,4-dibromoaniline;3,4-dibromo-N-methylaniline |
| SMILES | CNc1ccc(Br)c(Br)c1.Nc1ccc(Br)c(Br)c1 |
| InChI | InChI=1S/C7H7Br2N.C6H5Br2N/c1-10-5-2-3-6(8)7(9)4-5;7-5-2-1-4(9)3-6(5)8/h2-4,10H,1H3;1-3H,9H2 |
| InChIKey | HKOKQCGOBXLSRW-UHFFFAOYSA-N |
| XLogP | 6.05 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.87 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|