C22H20N2O4 — CID 158513452
1-(4-aminophenyl)-2-[5-[2-(4-aminophenyl)-2-oxoethyl]-2,4-dihydroxyphenyl]ethanone (PubChem CID 158513452) has the molecular formula C22H20N2O4 and a molecular weight of 376.41 g/mol. Its IUPAC name is 1-(4-aminophenyl)-2-[5-[2-(4-aminophenyl)-2-oxoethyl]-2,4-dihydroxyphenyl]ethanone.
| Compound Name | 1-(4-aminophenyl)-2-[5-[2-(4-aminophenyl)-2-oxoethyl]-2,4-dihydroxyphenyl]ethanone |
|---|---|
| PubChem CID | 158513452 |
| Molecular Formula | C22H20N2O4 |
| Molecular Weight | 376.41 g/mol |
| Exact Mass | 376.14 |
| IUPAC Name | 1-(4-aminophenyl)-2-[5-[2-(4-aminophenyl)-2-oxoethyl]-2,4-dihydroxyphenyl]ethanone |
| SMILES | Nc1ccc(C(=O)Cc2cc(CC(=O)c3ccc(N)cc3)c(O)cc2O)cc1 |
| InChI | InChI=1S/C22H20N2O4/c23-17-5-1-13(2-6-17)19(25)10-15-9-16(22(28)12-21(15)27)11-20(26)14-3-7-18(24)8-4-14/h1-9,12,27-28H,10-11,23-24H2 |
| InChIKey | MWUCKKKCYOFXMA-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 126.64 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.41 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|