C16H17F2NO — CID 169208742
2-(5-amino-2,4-difluorophenyl)-1-phenylethanone;ethane (PubChem CID 169208742) has the molecular formula C16H17F2NO and a molecular weight of 277.31 g/mol. Its IUPAC name is 2-(5-amino-2,4-difluorophenyl)-1-phenylethanone;ethane.
| Compound Name | 2-(5-amino-2,4-difluorophenyl)-1-phenylethanone;ethane |
|---|---|
| PubChem CID | 169208742 |
| Molecular Formula | C16H17F2NO |
| Molecular Weight | 277.31 g/mol |
| Exact Mass | 277.13 |
| IUPAC Name | 2-(5-amino-2,4-difluorophenyl)-1-phenylethanone;ethane |
| SMILES | CC.Nc1cc(CC(=O)c2ccccc2)c(F)cc1F |
| InChI | InChI=1S/C14H11F2NO.C2H6/c15-11-8-12(16)13(17)6-10(11)7-14(18)9-4-2-1-3-5-9;1-2/h1-6,8H,7,17H2;1-2H3 |
| InChIKey | IWHLMUCSSARFRC-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.31 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|