C26H34FN3O3 — CID 158518473
(2S)-N-[(2S)-1-[(2S,4S)-4-fluoro-4-methyl-2-[2-[(1S)-1,2,3,4-tetrahydronaphthalen-1-yl]acetyl]pyrrolidin-1-yl]-1-oxopent-4-yn-2-yl]-2-(methylamino)propanamide (PubChem CID 158518473) has the molecular formula C26H34FN3O3 and a molecular weight of 455.57 g/mol. Its IUPAC name is (2S)-N-[(2S)-1-[(2S,4S)-4-fluoro-4-methyl-2-[2-[(1S)-1,2,3,4-tetrahydronaphthalen-1-yl]acetyl]pyrrolidin-1-yl]-1-oxopent-4-yn-2-yl]-2-(methylamino)propanamide.
| Compound Name | (2S)-N-[(2S)-1-[(2S,4S)-4-fluoro-4-methyl-2-[2-[(1S)-1,2,3,4-tetrahydronaphthalen-1-yl]acetyl]pyrrolidin-1-yl]-1-oxopent-4-yn-2-yl]-2-(methylamino)propanamide |
|---|---|
| PubChem CID | 158518473 |
| Molecular Formula | C26H34FN3O3 |
| Molecular Weight | 455.57 g/mol |
| Exact Mass | 455.26 |
| IUPAC Name | (2S)-N-[(2S)-1-[(2S,4S)-4-fluoro-4-methyl-2-[2-[(1S)-1,2,3,4-tetrahydronaphthalen-1-yl]acetyl]pyrrolidin-1-yl]-1-oxopent-4-yn-2-yl]-2-(methylamino)propanamide |
| SMILES | C#CC[C@H](NC(=O)[C@H](C)NC)C(=O)N1C[C@@](C)(F)C[C@H]1C(=O)C[C@@H]1CCCc2ccccc21 |
| InChI | InChI=1S/C26H34FN3O3/c1-5-9-21(29-24(32)17(2)28-4)25(33)30-16-26(3,27)15-22(30)23(31)14-19-12-8-11-18-10-6-7-13-20(18)19/h1,6-7,10,13,17,19,21-22,28H,8-9,11-12,14-16H2,2-4H3,(H,29,32)/t17-,19-,21-,22-,26-/m0/s1 |
| InChIKey | HLXPHBJYPVWIKT-HOAZHDNCSA-N |
| XLogP | 2.51 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.57 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|